Products 1390656-55-9
CAS 1390656-55-9 is the registry number for 6,8-Dichloro-1,2,3,4-tetrahydro-5H-pyrido[2,3-e][1,4]diazepin-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-1,2,3,4-tetrahydropyrido[2,3-e][1,4]diazepin-5-one (CAS 1390656-55-9) is a chemical compound with the molecular formula C8H7Cl2N3O and a molecular weight of 232.06 g/mol. IUPAC name: 6,8-dichloro-1,2,3,4-tetrahydropyrido[2,3-e][1,4]diazepin-5-one. InChIKey: LYPWPVOWSSWXDI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3O |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 6,8-dichloro-1,2,3,4-tetrahydropyrido[2,3-e][1,4]diazepin-5-one |
| InChIKey | LYPWPVOWSSWXDI-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)