CAS 2080361-32-4 is the registry number for 5-(4,6-Dichloropyrimidin-2-yl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4,6-dichloropyrimidin-2-yl)pyrrolidin-2-one (CAS 2080361-32-4) is a chemical compound with the molecular formula C8H7Cl2N3O and a molecular weight of 232.06 g/mol. IUPAC name: 5-(4,6-dichloropyrimidin-2-yl)pyrrolidin-2-one. InChIKey: LYDHMRAGSGVASK-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3O |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 5-(4,6-dichloropyrimidin-2-yl)pyrrolidin-2-one |
| InChIKey | LYDHMRAGSGVASK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC1C2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)