CAS 2769718-08-1 is the registry number for 4,6-Dichloro-1,3-dimethyl-1,3-dihydro-2H-imidazo[4,5-c]pyridin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1,3-dimethylimidazo[4,5-c]pyridin-2-one (CAS 2769718-08-1) is a chemical compound with the molecular formula C8H7Cl2N3O and a molecular weight of 232.06 g/mol. IUPAC name: 4,6-dichloro-1,3-dimethylimidazo[4,5-c]pyridin-2-one. InChIKey: MNHGOUKPDHKRSJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3O |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 4,6-dichloro-1,3-dimethylimidazo[4,5-c]pyridin-2-one |
| InChIKey | MNHGOUKPDHKRSJ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=NC(=C2N(C1=O)C)Cl)Cl |
Computed by PubChem (NCBI)