Products 1390710-89-0

CAS 1390710-89-0 is the registry number for (S)-4-amino-7-methoxychromane-6-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4S)-4-amino-7-methoxy-3,4-dihydro-2H-chromene-6-carboxylic acid (CAS 1390710-89-0) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (4S)-4-amino-7-methoxy-3,4-dihydro-2H-chromene-6-carboxylic acid. InChIKey: DLNHQLSOFKGSRJ-QMMMGPOBSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC name(4S)-4-amino-7-methoxy-3,4-dihydro-2H-chromene-6-carboxylic acid
InChIKeyDLNHQLSOFKGSRJ-QMMMGPOBSA-N
SMILESCOC1=C(C=C2[C@H](CCOC2=C1)N)C(=O)O

Computed by PubChem (NCBI)