Products 1391267-58-5

CAS 1391267-58-5 is the registry number for 4-Amino-7-methoxychromane-6-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-amino-7-methoxy-3,4-dihydro-2H-chromene-6-carboxylic acid (CAS 1391267-58-5) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 4-amino-7-methoxy-3,4-dihydro-2H-chromene-6-carboxylic acid. InChIKey: DLNHQLSOFKGSRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC name4-amino-7-methoxy-3,4-dihydro-2H-chromene-6-carboxylic acid
InChIKeyDLNHQLSOFKGSRJ-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(CCOC2=C1)N)C(=O)O

Computed by PubChem (NCBI)