CAS 139079-39-3 appears in our catalog under these names: Quetiapine Impurity C(EP), 7-Hydroxy Quetiapine, >95% (HPLC), 7-Hydroxy Quetiapine (1.0 mg/mL in Methanol), 7–Hydroxyquetiapine solution, 7-Hydroxyquetiapine. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 10x1ml, 1x1ml, 1ml, 1 mg.
6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]benzo[b][1,4]benzothiazepin-2-ol (CAS 139079-39-3) is a chemical compound with the molecular formula C21H25N3O3S and a molecular weight of 399.5 g/mol. IUPAC name: 6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]benzo[b][1,4]benzothiazepin-2-ol. InChIKey: VEGVCHRFYPFJFO-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O3S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]benzo[b][1,4]benzothiazepin-2-ol |
| InChIKey | VEGVCHRFYPFJFO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCCO)C2=NC3=C(C=C(C=C3)O)SC4=CC=CC=C42 |
Computed by PubChem (NCBI)