CAS 153624-15-8 is the registry number for BMS-187308. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-amino-4-(2-methylpropyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide (CAS 153624-15-8) is a chemical compound with the molecular formula C21H25N3O3S and a molecular weight of 399.5 g/mol. IUPAC name: 2-[2-amino-4-(2-methylpropyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide. InChIKey: OZDIAVKCLFSBME-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O3S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 2-[2-amino-4-(2-methylpropyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
| InChIKey | OZDIAVKCLFSBME-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)CC(C)C)N |
Computed by PubChem (NCBI)