CAS 9025-02-9 is the registry number for α-Acetolactate decarboxylase, from Bacillus subtilis. Offered by: MedChemExpress. Available pack sizes: 1 g.
N-[4-[4-(2,3-dihydro-1H-inden-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide (CAS 9025-02-9) is a chemical compound with the molecular formula C21H25N3O3S and a molecular weight of 399.5 g/mol. IUPAC name: N-[4-[4-(2,3-dihydro-1H-inden-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide. InChIKey: KYLPQCURLYFTQK-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O3S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | N-[4-[4-(2,3-dihydro-1H-inden-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
| InChIKey | KYLPQCURLYFTQK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C3CC4=CC=CC=C4C3 |
Computed by PubChem (NCBI)