Products 1391008-15-3
CAS 1391008-15-3 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethoxy)-dl-phenylalanine, 95%, 2-Amino-3-(2-fluoro-4-(trifluoromethoxy)phenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-amino-3-[2-fluoro-4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1391008-15-3) is a chemical compound with the molecular formula C10H9F4NO3 and a molecular weight of 267.18 g/mol. IUPAC name: 2-amino-3-[2-fluoro-4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: POFOCSWADMUTGH-UHFFFAOYSA-N.
| Molecular formula | C10H9F4NO3 |
|---|---|
| Molecular weight | 267.18 g/mol |
| IUPAC name | 2-amino-3-[2-fluoro-4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | POFOCSWADMUTGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)