Products 2624416-81-3
CAS 2624416-81-3 is the registry number for 2,2,2-Trifluoro-N-(3-fluoro-2-(hydroxymethyl)-4-methoxyphenyl)acetamide, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2,2-trifluoro-N-[3-fluoro-2-(hydroxymethyl)-4-methoxyphenyl]acetamide (CAS 2624416-81-3) is a chemical compound with the molecular formula C10H9F4NO3 and a molecular weight of 267.18 g/mol. IUPAC name: 2,2,2-trifluoro-N-[3-fluoro-2-(hydroxymethyl)-4-methoxyphenyl]acetamide. InChIKey: JTCHWONGSOZSDZ-UHFFFAOYSA-N.
| Molecular formula | C10H9F4NO3 |
|---|---|
| Molecular weight | 267.18 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[3-fluoro-2-(hydroxymethyl)-4-methoxyphenyl]acetamide |
| InChIKey | JTCHWONGSOZSDZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)NC(=O)C(F)(F)F)CO)F |
Computed by PubChem (NCBI)