Products 2757405-72-2
CAS 2757405-72-2 is the registry number for (S)-4-Amino-5-fluoro-2-((1,1,1-trifluoropropan-2-yl)oxy)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzoic acid (CAS 2757405-72-2) is a chemical compound with the molecular formula C10H9F4NO3 and a molecular weight of 267.18 g/mol. IUPAC name: 4-amino-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzoic acid. InChIKey: BTIGUCVKCKQPKY-BYPYZUCNSA-N.
| Molecular formula | C10H9F4NO3 |
|---|---|
| Molecular weight | 267.18 g/mol |
| IUPAC name | 4-amino-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzoic acid |
| InChIKey | BTIGUCVKCKQPKY-BYPYZUCNSA-N |
| SMILES | C[C@@H](C(F)(F)F)OC1=CC(=C(C=C1C(=O)O)F)N |
Computed by PubChem (NCBI)