CAS 139101-67-0 appears in our catalog under these names: Tristan, 5-[2-(4-Hydroxy-3-methoxyphenyl)ethyl]-1,3-benzenediol, ≥98%, ≥98%, Tristin. Offered by: Chemat Brand, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 10 mg, 1 mg, 5 mg.
5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]benzene-1,3-diol (CAS 139101-67-0) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]benzene-1,3-diol. InChIKey: KPFFMALTIRFAHW-UHFFFAOYSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]benzene-1,3-diol |
| InChIKey | KPFFMALTIRFAHW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CCC2=CC(=CC(=C2)O)O)O |
Computed by PubChem (NCBI)