CAS 1391054-61-7 is the registry number for Benzocaine-13C6. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
Ethyl 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 1391054-61-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 171.15 g/mol. IUPAC name: ethyl 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: BLFLLBZGZJTVJG-LSYAIDEBSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | ethyl 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | BLFLLBZGZJTVJG-LSYAIDEBSA-N |
| SMILES | CCOC(=O)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)N |
Computed by PubChem (NCBI)