Products 342611-08-9
CAS 342611-08-9 appears in our catalog under these names: Benzocaine-d4, >95% (HPLC), Ethyl 4-Aminobenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, Benzocaine–d4, Benzocaine-d4, 99.00%, D4-Benzocaine. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 2,5mg, 5mg, 0,1g, 0,05g, 1mg, 5 mg, 10 mg.
Ethyl 4-amino-2,3,5,6-tetradeuteriobenzoate (CAS 342611-08-9) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 169.21 g/mol. IUPAC name: ethyl 4-amino-2,3,5,6-tetradeuteriobenzoate. InChIKey: BLFLLBZGZJTVJG-LNFUJOGGSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 169.21 g/mol |
| IUPAC name | ethyl 4-amino-2,3,5,6-tetradeuteriobenzoate |
| InChIKey | BLFLLBZGZJTVJG-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCC)[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)