Products 1391054-81-1
CAS 1391054-81-1 is the registry number for 2-(4-Amino-1,3,5-triazin-2-yl)sulfanylethanesulfonic Acid Potassium Salt. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]ethanesulfonic acid (CAS 1391054-81-1) is a chemical compound with the molecular formula C5H8N4O3S2 and a molecular weight of 236.3 g/mol. IUPAC name: 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]ethanesulfonic acid. InChIKey: ICGPQDWXRMFMCX-UHFFFAOYSA-N.
| Molecular formula | C5H8N4O3S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]ethanesulfonic acid |
| InChIKey | ICGPQDWXRMFMCX-UHFFFAOYSA-N |
| SMILES | C1=NC(=NC(=N1)SCCS(=O)(=O)O)N |
Computed by PubChem (NCBI)