CAS 68300-47-0 is the registry number for N-(5-(N-Methylsulfamoyl)-1,3,4-thiadiazol-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-(methylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide (CAS 68300-47-0) is a chemical compound with the molecular formula C5H8N4O3S2 and a molecular weight of 236.3 g/mol. IUPAC name: N-[5-(methylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide. InChIKey: BOWMCVIYCOFFNW-UHFFFAOYSA-N.
| Molecular formula | C5H8N4O3S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | N-[5-(methylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
| InChIKey | BOWMCVIYCOFFNW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NN=C(S1)S(=O)(=O)NC |
Computed by PubChem (NCBI)