CAS 1795142-30-1 appears in our catalog under these names: Methazolamide–d6, Methazolamide-d6. Offered by: GLPBio, TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 10mg, 50mg, 1 mg, 500 μg.
2,2,2-trideuterio-N-[5-sulfamoyl-3-(trideuteriomethyl)-1,3,4-thiadiazol-2-ylidene]acetamide (CAS 1795142-30-1) is a chemical compound with the molecular formula C5H8N4O3S2 and a molecular weight of 242.3 g/mol. IUPAC name: 2,2,2-trideuterio-N-[5-sulfamoyl-3-(trideuteriomethyl)-1,3,4-thiadiazol-2-ylidene]acetamide. InChIKey: FLOSMHQXBMRNHR-WFGJKAKNSA-N.
| Molecular formula | C5H8N4O3S2 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[5-sulfamoyl-3-(trideuteriomethyl)-1,3,4-thiadiazol-2-ylidene]acetamide |
| InChIKey | FLOSMHQXBMRNHR-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N=C1N(N=C(S1)S(=O)(=O)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)