CAS 1391068-09-9 is the registry number for N-Acetyl-S-(4-(2-pyridinyl)benzyl)-L-cysteine. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
(2R)-2-acetamido-3-[(4-pyridin-2-ylphenyl)methylsulfanyl]propanoic acid (CAS 1391068-09-9) is a chemical compound with the molecular formula C17H18N2O3S and a molecular weight of 330.4 g/mol. IUPAC name: (2R)-2-acetamido-3-[(4-pyridin-2-ylphenyl)methylsulfanyl]propanoic acid. InChIKey: XZBPUXNKKKMWON-INIZCTEOSA-N.
| Molecular formula | C17H18N2O3S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (2R)-2-acetamido-3-[(4-pyridin-2-ylphenyl)methylsulfanyl]propanoic acid |
| InChIKey | XZBPUXNKKKMWON-INIZCTEOSA-N |
| SMILES | CC(=O)N[C@@H](CSCC1=CC=C(C=C1)C2=CC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)