Products 335621-03-9

CAS 335621-03-9 is the registry number for 3-((4-Cyanophenyl)amino)propyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-cyanoanilino)propyl 4-methylbenzenesulfonate (CAS 335621-03-9) is a chemical compound with the molecular formula C17H18N2O3S and a molecular weight of 330.4 g/mol. IUPAC name: 3-(4-cyanoanilino)propyl 4-methylbenzenesulfonate. InChIKey: DMKUNHJZZHMFFE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18N2O3S
Molecular weight330.4 g/mol
IUPAC name3-(4-cyanoanilino)propyl 4-methylbenzenesulfonate
InChIKeyDMKUNHJZZHMFFE-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCCNC2=CC=C(C=C2)C#N

Computed by PubChem (NCBI)