CAS 296790-98-2 is the registry number for 4-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]-2-isopropyl-5-methylphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenol (CAS 296790-98-2) is a chemical compound with the molecular formula C17H18N2O3S and a molecular weight of 330.4 g/mol. IUPAC name: 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenol. InChIKey: HXBJIGYKYDLFGM-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenol |
| InChIKey | HXBJIGYKYDLFGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC2=NS(=O)(=O)C3=CC=CC=C32)C(C)C)O |
Computed by PubChem (NCBI)