Products 1391354-71-4
CAS 1391354-71-4 appears in our catalog under these names: (2R)-2-Amino-2-(3-methylphenyl)ethan-1-ol hydrochloride, 95%, (R)–2–Amino–2–(m–tolyl)ethanol hydrochloride, (R)-2-Amino-2-(m-tolyl)ethanol hydrochloride, 95%, 95%, (R)-2-Amino-2-(m-tolyl)ethanol hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-2-(3-methylphenyl)ethanol;hydrochloride (CAS 1391354-71-4) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (2R)-2-amino-2-(3-methylphenyl)ethanol;hydrochloride. InChIKey: IHNWJJLKSBXLRI-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-methylphenyl)ethanol;hydrochloride |
| InChIKey | IHNWJJLKSBXLRI-FVGYRXGTSA-N |
| SMILES | CC1=CC(=CC=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)