CAS 1391378-45-2 appears in our catalog under these names: (R)-2-Methyl-1-(p-tolyl)propan-1-amine hydrochloride, 98%, 98%, (R)-2-Methyl-1-(p-tolyl)propan-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1R)-2-methyl-1-(4-methylphenyl)propan-1-amine;hydrochloride (CAS 1391378-45-2) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-2-methyl-1-(4-methylphenyl)propan-1-amine;hydrochloride. InChIKey: QQAYCEWJQMBYRH-RFVHGSKJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-2-methyl-1-(4-methylphenyl)propan-1-amine;hydrochloride |
| InChIKey | QQAYCEWJQMBYRH-RFVHGSKJSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H](C(C)C)N.Cl |
Computed by PubChem (NCBI)