CAS 1391543-80-8 is the registry number for 1,2,4]Triazolo[1,5-a][1,3,5]triazin-7-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-[(3S)-morpholin-3-yl]benzoate;hydrochloride (CAS 1391543-80-8) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: methyl 4-[(3S)-morpholin-3-yl]benzoate;hydrochloride. InChIKey: RVMGNLHHGRSBRX-RFVHGSKJSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | methyl 4-[(3S)-morpholin-3-yl]benzoate;hydrochloride |
| InChIKey | RVMGNLHHGRSBRX-RFVHGSKJSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@H]2COCCN2.Cl |
Computed by PubChem (NCBI)