CAS 1391592-93-0 appears in our catalog under these names: (2R)-2-Amino-2-(2-methylphenyl)ethan-1-ol hydrochloride, 95%, (R)–2–Amino–2–(o–tolyl)ethan–1–ol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-2-(2-methylphenyl)ethanol;hydrochloride (CAS 1391592-93-0) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (2R)-2-amino-2-(2-methylphenyl)ethanol;hydrochloride. InChIKey: XRCVRMHELDJLFA-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-methylphenyl)ethanol;hydrochloride |
| InChIKey | XRCVRMHELDJLFA-FVGYRXGTSA-N |
| SMILES | CC1=CC=CC=C1[C@H](CO)N.Cl |
Computed by PubChem (NCBI)