Products 1392218-82-4
CAS 1392218-82-4 appears in our catalog under these names: (S)-6-Methylchroman-4-amine hydrochloride, 95%, (S)-6-Methylchroman-4-amine hydrochloride 97%, (S)-6-Methylchroman-4-amine hydrochloride, 97%, (S)-6-Methylchroman-4-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(4S)-6-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1392218-82-4) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (4S)-6-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: XDTASUXSWBNHHX-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (4S)-6-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | XDTASUXSWBNHHX-FVGYRXGTSA-N |
| SMILES | CC1=CC2=C(C=C1)OCC[C@@H]2N.Cl |
Computed by PubChem (NCBI)