Products 1638763-54-8
CAS 1638763-54-8 appears in our catalog under these names: 3-Benzyloxetan-3-amine hydrochloride, 95%, 3-Benzyloxetan-3-amine hydrochloride, 97%, 3-benzyloxetan-3-amine hcl, 3-Benzyloxetan-3-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 0,5g, 50mg, 500mg.
3-benzyloxetan-3-amine;hydrochloride (CAS 1638763-54-8) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 3-benzyloxetan-3-amine;hydrochloride. InChIKey: VMTNJXNTIVAKED-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 3-benzyloxetan-3-amine;hydrochloride |
| InChIKey | VMTNJXNTIVAKED-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)