CAS 191104-46-8 appears in our catalog under these names: 3-Amino-1-phenylbutan-2-one hydrochloride, 95%, 3–Amino–1–phenylbutan–2–one hydrochloride, 3-Amino-1-phenylbutan-2-one hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-amino-1-phenylbutan-2-one;hydrochloride (CAS 191104-46-8) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 3-amino-1-phenylbutan-2-one;hydrochloride. InChIKey: UKQLGHQKJOEJKH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 3-amino-1-phenylbutan-2-one;hydrochloride |
| InChIKey | UKQLGHQKJOEJKH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)