Products 1392224-56-4
CAS 1392224-56-4 is the registry number for 1,8-Dihydroxy-p-menth-3-en-2-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-hydroxy-3-(2-hydroxypropan-2-yl)-6-methylcyclohex-2-en-1-one (CAS 1392224-56-4) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 6-hydroxy-3-(2-hydroxypropan-2-yl)-6-methylcyclohex-2-en-1-one. InChIKey: QGCSRXXUIPOZJS-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 6-hydroxy-3-(2-hydroxypropan-2-yl)-6-methylcyclohex-2-en-1-one |
| InChIKey | QGCSRXXUIPOZJS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=CC1=O)C(C)(C)O)O |
Computed by PubChem (NCBI)
Synonyms:
1,8-Dihydroxy-p-menth-3-en-2-one, orb1680865