Products 1392492-03-3

CAS 1392492-03-3 is the registry number for Tropine 4-fluorobenzoate. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-fluorobenzoate (CAS 1392492-03-3) is a chemical compound with the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. IUPAC name: (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-fluorobenzoate. InChIKey: YXDFSLSXLYAAPF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18FNO2
Molecular weight263.31 g/mol
IUPAC name(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-fluorobenzoate
InChIKeyYXDFSLSXLYAAPF-UHFFFAOYSA-N
SMILESCN1C2CCC1CC(C2)OC(=O)C3=CC=C(C=C3)F

Computed by PubChem (NCBI)