CAS 878208-57-2 appears in our catalog under these names: (6-fluorochroman-2-yl)(piperidin-1-yl)methanone, 1-((6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)carbonyl)piperidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 500mg.
(6-fluoro-3,4-dihydro-2H-chromen-2-yl)-piperidin-1-ylmethanone (CAS 878208-57-2) is a chemical compound with the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. IUPAC name: (6-fluoro-3,4-dihydro-2H-chromen-2-yl)-piperidin-1-ylmethanone. InChIKey: KCQCIGZMHMLFSE-UHFFFAOYSA-N.
| Molecular formula | C15H18FNO2 |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | (6-fluoro-3,4-dihydro-2H-chromen-2-yl)-piperidin-1-ylmethanone |
| InChIKey | KCQCIGZMHMLFSE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2CCC3=C(O2)C=CC(=C3)F |
Computed by PubChem (NCBI)