Products 2757097-09-7
CAS 2757097-09-7 is the registry number for (6R,7AS)-7a-((benzyloxy)methyl)-6-fluorohexahydro-3H-pyrrolizin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,8S)-6-fluoro-8-(phenylmethoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CAS 2757097-09-7) is a chemical compound with the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. IUPAC name: (6R,8S)-6-fluoro-8-(phenylmethoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one. InChIKey: RIJXUBCUERLYLX-HIFRSBDPSA-N.
| Molecular formula | C15H18FNO2 |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | (6R,8S)-6-fluoro-8-(phenylmethoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| InChIKey | RIJXUBCUERLYLX-HIFRSBDPSA-N |
| SMILES | C1C[C@]2(C[C@H](CN2C1=O)F)COCC3=CC=CC=C3 |
Computed by PubChem (NCBI)