Products 1392493-37-6
CAS 1392493-37-6 is the registry number for 2-Amino-5-chloro-N,3-dimethylbenzamide-d3. Offered by: TRC. Available pack sizes: 100mg.
2-amino-5-chloro-3-methyl-N-(trideuteriomethyl)benzamide (CAS 1392493-37-6) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 201.67 g/mol. IUPAC name: 2-amino-5-chloro-3-methyl-N-(trideuteriomethyl)benzamide. InChIKey: WOBVZGBINMTNKL-BMSJAHLVSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 2-amino-5-chloro-3-methyl-N-(trideuteriomethyl)benzamide |
| InChIKey | WOBVZGBINMTNKL-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)C1=C(C(=CC(=C1)Cl)C)N |
Computed by PubChem (NCBI)