Products 890707-28-5
CAS 890707-28-5 appears in our catalog under these names: 2–Amino–5–chloro–N,3–dimethylbenzamide, 2-Amino-5-chloro-N,3-dimethylbenzamide, 2-Amino-5-chloro-N,3-dimethylbenzamide, >95% (HPLC), 2-Amino-5-chloro-N,3-dimethylbenzamide 95%, 2-Amino-5-chloro-N,3-dimethylbenzamide, 98%, 98%. Offered by: GLPBio, Biosynth, TRC, Ambeed, Chemat. Available pack sizes: 100g, 25g, 10g, 5g, 100mg, 1g, 250mg, 500g.
2-amino-5-chloro-N,3-dimethylbenzamide (CAS 890707-28-5) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 2-amino-5-chloro-N,3-dimethylbenzamide. InChIKey: WOBVZGBINMTNKL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 2-amino-5-chloro-N,3-dimethylbenzamide |
| InChIKey | WOBVZGBINMTNKL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C(=O)NC)Cl |
Computed by PubChem (NCBI)