CAS 1392516-27-6 is the registry number for Methyl 4–bromo–3–(tert–butyl)isoxazole–5–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Methyl 4-bromo-3-tert-butyl-1,2-oxazole-5-carboxylate (CAS 1392516-27-6) is a chemical compound with the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. IUPAC name: methyl 4-bromo-3-tert-butyl-1,2-oxazole-5-carboxylate. InChIKey: ZBSLAKRMHOAGPC-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | methyl 4-bromo-3-tert-butyl-1,2-oxazole-5-carboxylate |
| InChIKey | ZBSLAKRMHOAGPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=C1Br)C(=O)OC |
Computed by PubChem (NCBI)