Products 1803584-58-8

CAS 1803584-58-8 is the registry number for 4-(2-Aminoethyl)-3-hydroxybenzoic acid hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(2-aminoethyl)-3-hydroxybenzoic acid;hydrobromide (CAS 1803584-58-8) is a chemical compound with the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. IUPAC name: 4-(2-aminoethyl)-3-hydroxybenzoic acid;hydrobromide. InChIKey: HFTPLWNLSBUCIR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BrNO3
Molecular weight262.10 g/mol
IUPAC name4-(2-aminoethyl)-3-hydroxybenzoic acid;hydrobromide
InChIKeyHFTPLWNLSBUCIR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)O)CCN.Br

Computed by PubChem (NCBI)