CAS 1803584-58-8 is the registry number for 4-(2-Aminoethyl)-3-hydroxybenzoic acid hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-aminoethyl)-3-hydroxybenzoic acid;hydrobromide (CAS 1803584-58-8) is a chemical compound with the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. IUPAC name: 4-(2-aminoethyl)-3-hydroxybenzoic acid;hydrobromide. InChIKey: HFTPLWNLSBUCIR-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 4-(2-aminoethyl)-3-hydroxybenzoic acid;hydrobromide |
| InChIKey | HFTPLWNLSBUCIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)CCN.Br |
Computed by PubChem (NCBI)