Products 13928-68-2
CAS 13928-68-2 is the registry number for 5,7-Dimethyladamantane-1,3-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,7-dimethyladamantane-1,3-dicarboxylic acid (CAS 13928-68-2) is a chemical compound with the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. IUPAC name: 5,7-dimethyladamantane-1,3-dicarboxylic acid. InChIKey: KGFHKUZOSKDAKW-UHFFFAOYSA-N.
| Molecular formula | C14H20O4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 5,7-dimethyladamantane-1,3-dicarboxylic acid |
| InChIKey | KGFHKUZOSKDAKW-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
5,7-dimethyladamantane-1,3-dicarboxylic acid, tricyclo[3.3.1.1~3,7~]decane-1,3-dicarboxylic acid, 5,7-dimethyl-, Tricyclo[3.3.1.13,7]decane-1,3-dicarboxylic acid, 5,7-dimethyl-, 1,3-Dimethyl-5,7-adamantanedicarboxylic acid, Cambridge id 5347789, Oprea1_190570, 5,7-dimethyladamantane-1,3-dicarboxylic acid, AldrichCPR