CAS 17768-28-4 appears in our catalog under these names: 1,3-Adamantanediacetic acid, 98%, 2,2'–(Adamantane–1,3–diyl)diacetic acid, 1,3-Adamantanediacetic acid, 1,3-Adamantanediacetic Acid, >98.0%(T), 2,2'-(Adamantane-1,3-diyl)diacetic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 100g, 250mg.
2-[3-(carboxymethyl)-1-adamantyl]acetic acid (CAS 17768-28-4) is a chemical compound with the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. IUPAC name: 2-[3-(carboxymethyl)-1-adamantyl]acetic acid. InChIKey: UTENGZNBNPABQE-UHFFFAOYSA-N.
| Molecular formula | C14H20O4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 2-[3-(carboxymethyl)-1-adamantyl]acetic acid |
| InChIKey | UTENGZNBNPABQE-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)