CAS 84454-62-6 is the registry number for 1-Methoxycarbonyl-adamantan-4-one ethylene ketal, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate (CAS 84454-62-6) is a chemical compound with the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. IUPAC name: methyl spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate. InChIKey: IJJBOFUSNCAQQK-UHFFFAOYSA-N.
| Molecular formula | C14H20O4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | methyl spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate |
| InChIKey | IJJBOFUSNCAQQK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)C4(C(C3)C2)OCCO4 |
Computed by PubChem (NCBI)