CAS 1392803-55-2 appears in our catalog under these names: trans–3–(Boc–amino)–2, 2–dimethylcyclobutylamine, Trans-3-(boc-amino)-2,2-dimethylcyclobutylamine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(1S,3S)-3-amino-2,2-dimethylcyclobutyl]carbamate (CAS 1392803-55-2) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1S,3S)-3-amino-2,2-dimethylcyclobutyl]carbamate. InChIKey: LMCOQMMIAHCCFN-YUMQZZPRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1S,3S)-3-amino-2,2-dimethylcyclobutyl]carbamate |
| InChIKey | LMCOQMMIAHCCFN-YUMQZZPRSA-N |
| SMILES | CC1([C@H](C[C@@H]1NC(=O)OC(C)(C)C)N)C |
Computed by PubChem (NCBI)