CAS 1932320-58-5 is the registry number for tert–Butyl((1R,3S)–3–amino–2,2–dimethylcyclobutyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(1R,3S)-3-amino-2,2-dimethylcyclobutyl]carbamate (CAS 1932320-58-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-amino-2,2-dimethylcyclobutyl]carbamate. InChIKey: LMCOQMMIAHCCFN-JGVFFNPUSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-amino-2,2-dimethylcyclobutyl]carbamate |
| InChIKey | LMCOQMMIAHCCFN-JGVFFNPUSA-N |
| SMILES | CC1([C@H](C[C@H]1NC(=O)OC(C)(C)C)N)C |
Computed by PubChem (NCBI)