CAS 1392829-64-9 appears in our catalog under these names: 3,4-Dihydro-8-nitro-1H-1,4-benzodiazepine-2,5-dione, 98%, 98%, 8-Nitro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 1392829-64-9) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 8-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: NONXAFAIXDBIFU-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 8-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | NONXAFAIXDBIFU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC(=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)