Products 2483831-95-2
CAS 2483831-95-2 appears in our catalog under these names: Hexanoyl-L-carnitine-d3 HCl (N-methyl-d3), >95% (HPLC), Hexanoyl-L-carnitine-d3 HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Hexanoyl–L–carnitine–d3 (chloride), L–Hexanoylcarnitine–d3 chloride, L-Hexanoylcarnitine-d3 (chloride), 99.25%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 0,05g, 0,01g, 1mg, 5mg, 1 mg, 5 mg.
[(2R)-3-carboxy-2-hexanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (CAS 2483831-95-2) is a chemical compound with the molecular formula C13H26ClNO4 and a molecular weight of 298.82 g/mol. IUPAC name: [(2R)-3-carboxy-2-hexanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride. InChIKey: DTHGTKVOSRYXOK-OSGOKLQPSA-N.
| Molecular formula | C13H26ClNO4 |
|---|---|
| Molecular weight | 298.82 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hexanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| InChIKey | DTHGTKVOSRYXOK-OSGOKLQPSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCC.[Cl-] |
Computed by PubChem (NCBI)