CAS 1393175-93-3 is the registry number for (S)-1-(7-methyl-1-phenyl-1H-benzo[d]imidazol-2-yl)ethan-1-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(7-methyl-1-phenylbenzimidazol-2-yl)ethanamine (CAS 1393175-93-3) is a chemical compound with the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. IUPAC name: (1S)-1-(7-methyl-1-phenylbenzimidazol-2-yl)ethanamine. InChIKey: AUESLSUHCZOWNX-LBPRGKRZSA-N.
| Molecular formula | C16H17N3 |
|---|---|
| Molecular weight | 251.33 g/mol |
| IUPAC name | (1S)-1-(7-methyl-1-phenylbenzimidazol-2-yl)ethanamine |
| InChIKey | AUESLSUHCZOWNX-LBPRGKRZSA-N |
| SMILES | CC1=C2C(=CC=C1)N=C(N2C3=CC=CC=C3)[C@H](C)N |
Computed by PubChem (NCBI)