Products 416867-06-6
CAS 416867-06-6 appears in our catalog under these names: N-((2,4-Dimethylphenyl)methyl)-1H-indazol-5-amine, 95%, N-((2,4-Dimethylphenyl)methyl)-1H-indazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N-[(2,4-dimethylphenyl)methyl]-1H-indazol-5-amine (CAS 416867-06-6) is a chemical compound with the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. IUPAC name: N-[(2,4-dimethylphenyl)methyl]-1H-indazol-5-amine. InChIKey: LQRMVAOHLPVKOR-UHFFFAOYSA-N.
| Molecular formula | C16H17N3 |
|---|---|
| Molecular weight | 251.33 g/mol |
| IUPAC name | N-[(2,4-dimethylphenyl)methyl]-1H-indazol-5-amine |
| InChIKey | LQRMVAOHLPVKOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CNC2=CC3=C(C=C2)NN=C3)C |
Computed by PubChem (NCBI)