CAS 304870-34-6 appears in our catalog under these names: 6H-Spiro(benzo(h)quinazoline-5,1'-cyclopentane)-4-amine, 98%, 6H-Spiro(benzo(H)quinazoline-5,1'-cyclopentane)-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-amine (CAS 304870-34-6) is a chemical compound with the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. IUPAC name: spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-amine. InChIKey: UEARIUHHXUNAIO-UHFFFAOYSA-N.
| Molecular formula | C16H17N3 |
|---|---|
| Molecular weight | 251.33 g/mol |
| IUPAC name | spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-amine |
| InChIKey | UEARIUHHXUNAIO-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC3=CC=CC=C3C4=C2C(=NC=N4)N |
Computed by PubChem (NCBI)