CAS 1393442-27-7 is the registry number for 3-(4-Methylphenyl)carbonyl-1-tosylpyrrole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(4-methylphenyl)-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]methanone (CAS 1393442-27-7) is a chemical compound with the molecular formula C19H17NO3S and a molecular weight of 339.4 g/mol. IUPAC name: (4-methylphenyl)-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]methanone. InChIKey: LBXUAWLWBIQOMB-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (4-methylphenyl)-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]methanone |
| InChIKey | LBXUAWLWBIQOMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CN(C=C2)S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)