Products 474843-40-8

CAS 474843-40-8 is the registry number for 3-Amino-5-(4-benzyloxyphenyl)thiophene-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-5-(4-phenylmethoxyphenyl)thiophene-2-carboxylate (CAS 474843-40-8) is a chemical compound with the molecular formula C19H17NO3S and a molecular weight of 339.4 g/mol. IUPAC name: methyl 3-amino-5-(4-phenylmethoxyphenyl)thiophene-2-carboxylate. InChIKey: YIMYASTXYWDVQA-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17NO3S
Molecular weight339.4 g/mol
IUPAC namemethyl 3-amino-5-(4-phenylmethoxyphenyl)thiophene-2-carboxylate
InChIKeyYIMYASTXYWDVQA-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)OCC3=CC=CC=C3)N

Computed by PubChem (NCBI)