CAS 474843-40-8 is the registry number for 3-Amino-5-(4-benzyloxyphenyl)thiophene-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-amino-5-(4-phenylmethoxyphenyl)thiophene-2-carboxylate (CAS 474843-40-8) is a chemical compound with the molecular formula C19H17NO3S and a molecular weight of 339.4 g/mol. IUPAC name: methyl 3-amino-5-(4-phenylmethoxyphenyl)thiophene-2-carboxylate. InChIKey: YIMYASTXYWDVQA-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | methyl 3-amino-5-(4-phenylmethoxyphenyl)thiophene-2-carboxylate |
| InChIKey | YIMYASTXYWDVQA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)