CAS 603952-64-3 appears in our catalog under these names: Tazarotenic Acid Sulfoxide, Tazarotenic Acid Sulfoxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
6-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylic acid (CAS 603952-64-3) is a chemical compound with the molecular formula C19H17NO3S and a molecular weight of 339.4 g/mol. IUPAC name: 6-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylic acid. InChIKey: SMCJVZRFBIOWHW-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 6-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylic acid |
| InChIKey | SMCJVZRFBIOWHW-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)C2=C1C=C(C=C2)C#CC3=NC=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)