Products 1393444-69-3
CAS 1393444-69-3 is the registry number for 4-((4-tert-Butylphenyl)(phenyl)methyl)benzoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
4-[(4-tert-butylphenyl)-phenylmethyl]benzoic acid (CAS 1393444-69-3) is a chemical compound with the molecular formula C24H24O2 and a molecular weight of 344.4 g/mol. IUPAC name: 4-[(4-tert-butylphenyl)-phenylmethyl]benzoic acid. InChIKey: YTRLFXJIWUOSDM-UHFFFAOYSA-N.
| Molecular formula | C24H24O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 4-[(4-tert-butylphenyl)-phenylmethyl]benzoic acid |
| InChIKey | YTRLFXJIWUOSDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)