Products 142096-81-9
CAS 142096-81-9 is the registry number for ((1R,2R)-2-((Trityloxy)methyl)cyclopropyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2R)-2-(trityloxymethyl)cyclopropyl]methanol (CAS 142096-81-9) is a chemical compound with the molecular formula C24H24O2 and a molecular weight of 344.4 g/mol. IUPAC name: [(1R,2R)-2-(trityloxymethyl)cyclopropyl]methanol. InChIKey: RIGYXNSQLNSSFL-PMACEKPBSA-N.
| Molecular formula | C24H24O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | [(1R,2R)-2-(trityloxymethyl)cyclopropyl]methanol |
| InChIKey | RIGYXNSQLNSSFL-PMACEKPBSA-N |
| SMILES | C1[C@H]([C@@H]1COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)CO |
Computed by PubChem (NCBI)